C22H28N4O3S2 — CID 46529966
7-methyl-3-(oxolan-2-ylmethyl)-2-[(3-propyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 46529966) has the molecular formula C22H28N4O3S2 and a molecular weight of 460.63 g/mol. Its IUPAC name is 7-methyl-3-(oxolan-2-ylmethyl)-2-[(3-propyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-methyl-3-(oxolan-2-ylmethyl)-2-[(3-propyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 46529966 |
| Molecular Formula | C22H28N4O3S2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 7-methyl-3-(oxolan-2-ylmethyl)-2-[(3-propyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCc1noc(CSc2nc3sc4c(c3c(=O)n2CC2CCCO2)CCC(C)C4)n1 |
| InChI | InChI=1S/C22H28N4O3S2/c1-3-5-17-23-18(29-25-17)12-30-22-24-20-19(15-8-7-13(2)10-16(15)31-20)21(27)26(22)11-14-6-4-9-28-14/h13-14H,3-12H2,1-2H3 |
| InChIKey | XSGMMORRIDHXPK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |