C24H26N4O4S — CID 24653440
N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-2-quinolin-8-ylacetamide (PubChem CID 24653440) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-2-quinolin-8-ylacetamide.
| Compound Name | N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-2-quinolin-8-ylacetamide |
|---|---|
| PubChem CID | 24653440 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-2-quinolin-8-ylacetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCC(NC(=O)Cc3cccc4cccnc34)CC2)cc1 |
| InChI | InChI=1S/C24H26N4O4S/c1-17(29)26-20-7-9-22(10-8-20)33(31,32)28-14-11-21(12-15-28)27-23(30)16-19-5-2-4-18-6-3-13-25-24(18)19/h2-10,13,21H,11-12,14-16H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | GHWIHCPRLBJKOK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |