C28H30N2O2 — CID 24655734
N-(1,4-diphenylbutyl)-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 24655734) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-(1,4-diphenylbutyl)-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-(1,4-diphenylbutyl)-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 24655734 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-(1,4-diphenylbutyl)-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | O=C(NC(CCCc1ccccc1)c1ccccc1)c1ccc(CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C28H30N2O2/c31-27-15-8-20-30(27)21-23-16-18-25(19-17-23)28(32)29-26(24-12-5-2-6-13-24)14-7-11-22-9-3-1-4-10-22/h1-6,9-10,12-13,16-19,26H,7-8,11,14-15,20-21H2,(H,29,32) |
| InChIKey | LNXMDUSOZSOVKN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |