C28H28N2O3 — CID 24552366
4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(1,4-diphenylbutyl)benzamide (PubChem CID 24552366) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(1,4-diphenylbutyl)benzamide.
| Compound Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(1,4-diphenylbutyl)benzamide |
|---|---|
| PubChem CID | 24552366 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(1,4-diphenylbutyl)benzamide |
| SMILES | O=C(NC(CCCc1ccccc1)c1ccccc1)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C28H28N2O3/c31-26-18-19-27(32)30(26)20-22-14-16-24(17-15-22)28(33)29-25(23-11-5-2-6-12-23)13-7-10-21-8-3-1-4-9-21/h1-6,8-9,11-12,14-17,25H,7,10,13,18-20H2,(H,29,33) |
| InChIKey | RARBLLKTZHOFTD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|