C23H23N3O3 — CID 24657741
naphthalen-1-ylmethyl 1-(5-carbamoyl-2-pyridinyl)piperidine-4-carboxylate (PubChem CID 24657741) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 1-(5-carbamoyl-2-pyridinyl)piperidine-4-carboxylate.
| Compound Name | naphthalen-1-ylmethyl 1-(5-carbamoyl-2-pyridinyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 24657741 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | naphthalen-1-ylmethyl 1-(5-carbamoyl-2-pyridinyl)piperidine-4-carboxylate |
| SMILES | NC(=O)c1ccc(N2CCC(C(=O)OCc3cccc4ccccc34)CC2)nc1 |
| InChI | InChI=1S/C23H23N3O3/c24-22(27)18-8-9-21(25-14-18)26-12-10-17(11-13-26)23(28)29-15-19-6-3-5-16-4-1-2-7-20(16)19/h1-9,14,17H,10-13,15H2,(H2,24,27) |
| InChIKey | POCSIDVHHXUZPE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |