C22H35N3O4S — CID 24658602
1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-2-(2-tert-butylphenoxy)ethanone (PubChem CID 24658602) has the molecular formula C22H35N3O4S and a molecular weight of 437.61 g/mol. Its IUPAC name is 1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-2-(2-tert-butylphenoxy)ethanone.
| Compound Name | 1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-2-(2-tert-butylphenoxy)ethanone |
|---|---|
| PubChem CID | 24658602 |
| Molecular Formula | C22H35N3O4S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-2-(2-tert-butylphenoxy)ethanone |
| SMILES | CC(C)(C)c1ccccc1OCC(=O)N1CCN(S(=O)(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C22H35N3O4S/c1-22(2,3)19-10-6-7-11-20(19)29-18-21(26)23-14-16-25(17-15-23)30(27,28)24-12-8-4-5-9-13-24/h6-7,10-11H,4-5,8-9,12-18H2,1-3H3 |
| InChIKey | VQFORRHOUVYKIB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |