C24H25ClN2OS — CID 24661064
2-chloro-N-[[2-[4-[(dimethylamino)methyl]phenyl]phenyl]methyl]-5-methylsulfanylbenzamide (PubChem CID 24661064) has the molecular formula C24H25ClN2OS and a molecular weight of 425.00 g/mol. Its IUPAC name is 2-chloro-N-[[2-[4-[(dimethylamino)methyl]phenyl]phenyl]methyl]-5-methylsulfanylbenzamide.
| Compound Name | 2-chloro-N-[[2-[4-[(dimethylamino)methyl]phenyl]phenyl]methyl]-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 24661064 |
| Molecular Formula | C24H25ClN2OS |
| Molecular Weight | 425.00 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-chloro-N-[[2-[4-[(dimethylamino)methyl]phenyl]phenyl]methyl]-5-methylsulfanylbenzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)NCc2ccccc2-c2ccc(CN(C)C)cc2)c1 |
| InChI | InChI=1S/C24H25ClN2OS/c1-27(2)16-17-8-10-18(11-9-17)21-7-5-4-6-19(21)15-26-24(28)22-14-20(29-3)12-13-23(22)25/h4-14H,15-16H2,1-3H3,(H,26,28) |
| InChIKey | ZZZZULKTCIEYFF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.00 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |