C23H32N6O2 — CID 24663821
2-[4-[(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile (PubChem CID 24663821) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-[4-[(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile.
| Compound Name | 2-[4-[(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 24663821 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 2-[4-[(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CN1CCN(c3cc(C#N)ccn3)CC1)C2=O |
| InChI | InChI=1S/C23H32N6O2/c1-22(2,3)18-4-7-23(8-5-18)20(30)29(21(31)26-23)16-27-10-12-28(13-11-27)19-14-17(15-24)6-9-25-19/h6,9,14,18H,4-5,7-8,10-13,16H2,1-3H3,(H,26,31) |
| InChIKey | FJETWXHANCTBIZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|