About 2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile
2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile (PubChem CID 24663868) has the molecular formula C18H22N6O3
and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile |
| PubChem CID | 24663868 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile |
| SMILES | CCCCN1C(=O)C(=O)N(CN2CCN(c3cc(C#N)ccn3)CC2)C1=O |
| InChI | InChI=1S/C18H22N6O3/c1-2-3-6-23-16(25)17(26)24(18(23)27)13-21-7-9-22(10-8-21)15-11-14(12-19)4-5-20-15/h4-5,11H,2-3,6-10,13H2,1H3 |
| InChIKey | RDJSJZLAYFDWRD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 100.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile?
The IUPAC name of 2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile (CID 24663868) is 2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile.
What is the SMILES notation for 2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile?
The canonical SMILES for 2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile is CCCCN1C(=O)C(=O)N(CN2CCN(c3cc(C#N)ccn3)CC2)C1=O.
What is the InChIKey of 2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile?
The InChIKey is RDJSJZLAYFDWRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N6O3/c1-2-3-6-23-16(25)17(26)24(18(23)27)13-21-7-9-22(10-8-21)15-11-14(12-19)4-5-20-15/h4-5,11H,2-3,6-10,13H2,1H3.
What are the key properties of 2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile?
2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile has a molecular weight of 370.41 g/mol, XLogP of 0.62, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile is sourced from PubChem (CID 24663868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).