C18H17BrF3N3O3 — CID 24665023
2-bromo-N'-[2-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]acetyl]benzohydrazide (PubChem CID 24665023) has the molecular formula C18H17BrF3N3O3 and a molecular weight of 460.25 g/mol. Its IUPAC name is 2-bromo-N'-[2-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]acetyl]benzohydrazide.
| Compound Name | 2-bromo-N'-[2-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 24665023 |
| Molecular Formula | C18H17BrF3N3O3 |
| Molecular Weight | 460.25 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 2-bromo-N'-[2-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]acetyl]benzohydrazide |
| SMILES | CN(CC(=O)NNC(=O)c1ccccc1Br)Cc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C18H17BrF3N3O3/c1-25(10-12-6-2-5-9-15(12)28-18(20,21)22)11-16(26)23-24-17(27)13-7-3-4-8-14(13)19/h2-9H,10-11H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | XEBMODUJIUNSIN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|