C10H10F3N3O2S — CID 87565512
[[2-[2-(trifluoromethoxy)phenyl]acetyl]amino]thiourea (PubChem CID 87565512) has the molecular formula C10H10F3N3O2S and a molecular weight of 293.27 g/mol. Its IUPAC name is [[2-[2-(trifluoromethoxy)phenyl]acetyl]amino]thiourea.
| Compound Name | [[2-[2-(trifluoromethoxy)phenyl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 87565512 |
| Molecular Formula | C10H10F3N3O2S |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | [[2-[2-(trifluoromethoxy)phenyl]acetyl]amino]thiourea |
| SMILES | NC(=S)NNC(=O)Cc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C10H10F3N3O2S/c11-10(12,13)18-7-4-2-1-3-6(7)5-8(17)15-16-9(14)19/h1-4H,5H2,(H,15,17)(H3,14,16,19) |
| InChIKey | WZGNVNYCQMJJTE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|