C23H17N3O3S — CID 24667542
N-dibenzofuran-2-yl-3-ethyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 24667542) has the molecular formula C23H17N3O3S and a molecular weight of 415.47 g/mol. Its IUPAC name is N-dibenzofuran-2-yl-3-ethyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-dibenzofuran-2-yl-3-ethyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 24667542 |
| Molecular Formula | C23H17N3O3S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-dibenzofuran-2-yl-3-ethyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | CCn1c(=S)[nH]c2cc(C(=O)Nc3ccc4oc5ccccc5c4c3)ccc2c1=O |
| InChI | InChI=1S/C23H17N3O3S/c1-2-26-22(28)16-9-7-13(11-18(16)25-23(26)30)21(27)24-14-8-10-20-17(12-14)15-5-3-4-6-19(15)29-20/h3-12H,2H2,1H3,(H,24,27)(H,25,30) |
| InChIKey | BFRZOCHEALUUCU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|