C18H17FN4O4S2 — CID 24677303
3-ethyl-N-[4-fluoro-3-(methanesulfonamido)phenyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 24677303) has the molecular formula C18H17FN4O4S2 and a molecular weight of 436.49 g/mol. Its IUPAC name is 3-ethyl-N-[4-fluoro-3-(methanesulfonamido)phenyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | 3-ethyl-N-[4-fluoro-3-(methanesulfonamido)phenyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 24677303 |
| Molecular Formula | C18H17FN4O4S2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 3-ethyl-N-[4-fluoro-3-(methanesulfonamido)phenyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | CCn1c(=S)[nH]c2cc(C(=O)Nc3ccc(F)c(NS(C)(=O)=O)c3)ccc2c1=O |
| InChI | InChI=1S/C18H17FN4O4S2/c1-3-23-17(25)12-6-4-10(8-14(12)21-18(23)28)16(24)20-11-5-7-13(19)15(9-11)22-29(2,26)27/h4-9,22H,3H2,1-2H3,(H,20,24)(H,21,28) |
| InChIKey | BNMYJHGPMPHSJN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|