C17H23N7OS — CID 24667649
3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(1,3,5-trimethylpyrazol-4-yl)propanamide (PubChem CID 24667649) has the molecular formula C17H23N7OS and a molecular weight of 373.49 g/mol. Its IUPAC name is 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(1,3,5-trimethylpyrazol-4-yl)propanamide.
| Compound Name | 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(1,3,5-trimethylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 24667649 |
| Molecular Formula | C17H23N7OS |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(1,3,5-trimethylpyrazol-4-yl)propanamide |
| SMILES | CSc1nc2nc(C)c(CCC(=O)Nc3c(C)nn(C)c3C)c(C)n2n1 |
| InChI | InChI=1S/C17H23N7OS/c1-9-13(11(3)24-16(18-9)20-17(22-24)26-6)7-8-14(25)19-15-10(2)21-23(5)12(15)4/h7-8H2,1-6H3,(H,19,25) |
| InChIKey | WIUADCXJTKMYPB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |