C15H19N7OS2 — CID 8777750
3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 8777750) has the molecular formula C15H19N7OS2 and a molecular weight of 377.50 g/mol. Its IUPAC name is 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 8777750 |
| Molecular Formula | C15H19N7OS2 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCc1nnc(NC(=O)CCc2c(C)nc3nc(SC)nn3c2C)s1 |
| InChI | InChI=1S/C15H19N7OS2/c1-5-12-19-20-14(25-12)17-11(23)7-6-10-8(2)16-13-18-15(24-4)21-22(13)9(10)3/h5-7H2,1-4H3,(H,17,20,23) |
| InChIKey | BDRQZJKLHNAMAE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |