C21H29N7O2S2 — CID 42933473
3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]propanamide (PubChem CID 42933473) has the molecular formula C21H29N7O2S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 42933473 |
| Molecular Formula | C21H29N7O2S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]propanamide |
| SMILES | CSc1nc2nc(C)c(CCC(=O)Nc3nc(CN4CC(C)OC(C)C4)cs3)c(C)n2n1 |
| InChI | InChI=1S/C21H29N7O2S2/c1-12-8-27(9-13(2)30-12)10-16-11-32-20(23-16)24-18(29)7-6-17-14(3)22-19-25-21(31-5)26-28(19)15(17)4/h11-13H,6-10H2,1-5H3,(H,23,24,29) |
| InChIKey | JVNSSOLGNAMSKX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |