C24H23ClN2O5S — CID 24667792
N-[2-chloro-4-[2-(4-methylphenoxy)propanoylamino]phenyl]-3-methylsulfonylbenzamide (PubChem CID 24667792) has the molecular formula C24H23ClN2O5S and a molecular weight of 486.98 g/mol. Its IUPAC name is N-[2-chloro-4-[2-(4-methylphenoxy)propanoylamino]phenyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[2-chloro-4-[2-(4-methylphenoxy)propanoylamino]phenyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 24667792 |
| Molecular Formula | C24H23ClN2O5S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | N-[2-chloro-4-[2-(4-methylphenoxy)propanoylamino]phenyl]-3-methylsulfonylbenzamide |
| SMILES | Cc1ccc(OC(C)C(=O)Nc2ccc(NC(=O)c3cccc(S(C)(=O)=O)c3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H23ClN2O5S/c1-15-7-10-19(11-8-15)32-16(2)23(28)26-18-9-12-22(21(25)14-18)27-24(29)17-5-4-6-20(13-17)33(3,30)31/h4-14,16H,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | LDZBQQKUHJQESA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |