C17H15ClN2O4S — CID 51236662
N-(3-chloro-4-cyanophenyl)-2-(4-methylsulfonylphenoxy)propanamide (PubChem CID 51236662) has the molecular formula C17H15ClN2O4S and a molecular weight of 378.84 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-(4-methylsulfonylphenoxy)propanamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-(4-methylsulfonylphenoxy)propanamide |
|---|---|
| PubChem CID | 51236662 |
| Molecular Formula | C17H15ClN2O4S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-(4-methylsulfonylphenoxy)propanamide |
| SMILES | CC(Oc1ccc(S(C)(=O)=O)cc1)C(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C17H15ClN2O4S/c1-11(24-14-5-7-15(8-6-14)25(2,22)23)17(21)20-13-4-3-12(10-19)16(18)9-13/h3-9,11H,1-2H3,(H,20,21) |
| InChIKey | JSHDPZNNUPRXRN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |