C22H24N2O3S — CID 24672160
N-butyl-2-(2,3-dimethoxyphenyl)-N-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 24672160) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-butyl-2-(2,3-dimethoxyphenyl)-N-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-2-(2,3-dimethoxyphenyl)-N-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 24672160 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-butyl-2-(2,3-dimethoxyphenyl)-N-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCN(C(=O)c1csc(-c2cccc(OC)c2OC)n1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O3S/c1-4-5-14-24(16-10-7-6-8-11-16)22(25)18-15-28-21(23-18)17-12-9-13-19(26-2)20(17)27-3/h6-13,15H,4-5,14H2,1-3H3 |
| InChIKey | WDOFOEGGPRZGJE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |