C20H18FNO4 — CID 24672781
N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-3,4-dimethoxybenzamide (PubChem CID 24672781) has the molecular formula C20H18FNO4 and a molecular weight of 355.37 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 24672781 |
| Molecular Formula | C20H18FNO4 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2ccc(-c3ccc(F)cc3)o2)cc1OC |
| InChI | InChI=1S/C20H18FNO4/c1-24-18-9-5-14(11-19(18)25-2)20(23)22-12-16-8-10-17(26-16)13-3-6-15(21)7-4-13/h3-11H,12H2,1-2H3,(H,22,23) |
| InChIKey | NDXSPJHXRDZZHO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |