C20H18FNO4 — CID 24677331
N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2-(2-methoxyphenoxy)acetamide (PubChem CID 24677331) has the molecular formula C20H18FNO4 and a molecular weight of 355.37 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 24677331 |
| Molecular Formula | C20H18FNO4 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)NCc1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C20H18FNO4/c1-24-18-4-2-3-5-19(18)25-13-20(23)22-12-16-10-11-17(26-16)14-6-8-15(21)9-7-14/h2-11H,12-13H2,1H3,(H,22,23) |
| InChIKey | KRMQQLYVWNKSGT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |