C21H17ClFNO4 — CID 112771182
2-(2-acetyl-4-fluorophenoxy)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]acetamide (PubChem CID 112771182) has the molecular formula C21H17ClFNO4 and a molecular weight of 401.82 g/mol. Its IUPAC name is 2-(2-acetyl-4-fluorophenoxy)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]acetamide.
| Compound Name | 2-(2-acetyl-4-fluorophenoxy)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 112771182 |
| Molecular Formula | C21H17ClFNO4 |
| Molecular Weight | 401.82 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 2-(2-acetyl-4-fluorophenoxy)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]acetamide |
| SMILES | CC(=O)c1cc(F)ccc1OCC(=O)NCc1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C21H17ClFNO4/c1-13(25)18-10-16(23)6-8-20(18)27-12-21(26)24-11-17-7-9-19(28-17)14-2-4-15(22)5-3-14/h2-10H,11-12H2,1H3,(H,24,26) |
| InChIKey | QFXWAHBLZPDOJP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.82 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |