C21H18Cl2N2O3S — CID 54860411
2-(4-chloro-2-methylphenoxy)-N-[[5-(4-chlorophenyl)furan-2-yl]methylcarbamothioyl]acetamide (PubChem CID 54860411) has the molecular formula C21H18Cl2N2O3S and a molecular weight of 449.36 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-[[5-(4-chlorophenyl)furan-2-yl]methylcarbamothioyl]acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-[[5-(4-chlorophenyl)furan-2-yl]methylcarbamothioyl]acetamide |
|---|---|
| PubChem CID | 54860411 |
| Molecular Formula | C21H18Cl2N2O3S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-[[5-(4-chlorophenyl)furan-2-yl]methylcarbamothioyl]acetamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)NC(=S)NCc1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C21H18Cl2N2O3S/c1-13-10-16(23)6-8-18(13)27-12-20(26)25-21(29)24-11-17-7-9-19(28-17)14-2-4-15(22)5-3-14/h2-10H,11-12H2,1H3,(H2,24,25,26,29) |
| InChIKey | GJJVIHMFCBCCAC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|