C24H25BrN2O3S — CID 54860237
N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-2-(4-tert-butylphenoxy)acetamide (PubChem CID 54860237) has the molecular formula C24H25BrN2O3S and a molecular weight of 501.45 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-2-(4-tert-butylphenoxy)acetamide.
| Compound Name | N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-2-(4-tert-butylphenoxy)acetamide |
|---|---|
| PubChem CID | 54860237 |
| Molecular Formula | C24H25BrN2O3S |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-2-(4-tert-butylphenoxy)acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NC(=S)NCc2ccc(-c3ccc(Br)cc3)o2)cc1 |
| InChI | InChI=1S/C24H25BrN2O3S/c1-24(2,3)17-6-10-19(11-7-17)29-15-22(28)27-23(31)26-14-20-12-13-21(30-20)16-4-8-18(25)9-5-16/h4-13H,14-15H2,1-3H3,(H2,26,27,28,31) |
| InChIKey | WWNSNRBZEOBOLG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|