C25H27BrN2O5S — CID 17334219
N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-3,4,5-triethoxybenzamide (PubChem CID 17334219) has the molecular formula C25H27BrN2O5S and a molecular weight of 547.47 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 17334219 |
| Molecular Formula | C25H27BrN2O5S |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)NCc2ccc(-c3ccc(Br)cc3)o2)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H27BrN2O5S/c1-4-30-21-13-17(14-22(31-5-2)23(21)32-6-3)24(29)28-25(34)27-15-19-11-12-20(33-19)16-7-9-18(26)10-8-16/h7-14H,4-6,15H2,1-3H3,(H2,27,28,29,34) |
| InChIKey | ZRELHTJJHCYARN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|