C20H16BrN3O5S — CID 17334255
N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-4-methoxy-3-nitrobenzamide (PubChem CID 17334255) has the molecular formula C20H16BrN3O5S and a molecular weight of 490.34 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 17334255 |
| Molecular Formula | C20H16BrN3O5S |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.00 |
| IUPAC Name | N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)NCc2ccc(-c3ccc(Br)cc3)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16BrN3O5S/c1-28-18-8-4-13(10-16(18)24(26)27)19(25)23-20(30)22-11-15-7-9-17(29-15)12-2-5-14(21)6-3-12/h2-10H,11H2,1H3,(H2,22,23,25,30) |
| InChIKey | UZTOYOVDCJGHJZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|