C20H16Br2N2O3S — CID 54860262
2-(4-bromophenoxy)-N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]acetamide (PubChem CID 54860262) has the molecular formula C20H16Br2N2O3S and a molecular weight of 524.23 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]acetamide |
|---|---|
| PubChem CID | 54860262 |
| Molecular Formula | C20H16Br2N2O3S |
| Molecular Weight | 524.23 g/mol |
| Exact Mass | 521.92 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]acetamide |
| SMILES | O=C(COc1ccc(Br)cc1)NC(=S)NCc1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C20H16Br2N2O3S/c21-14-3-1-13(2-4-14)18-10-9-17(27-18)11-23-20(28)24-19(25)12-26-16-7-5-15(22)6-8-16/h1-10H,11-12H2,(H2,23,24,25,28) |
| InChIKey | QXXVIYRXZFYSGJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.23 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|