C23H15BrCl2N2O3S — CID 17334498
N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide (PubChem CID 17334498) has the molecular formula C23H15BrCl2N2O3S and a molecular weight of 550.26 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17334498 |
| Molecular Formula | C23H15BrCl2N2O3S |
| Molecular Weight | 550.26 g/mol |
| Exact Mass | 547.94 |
| IUPAC Name | N-[[5-(4-bromophenyl)furan-2-yl]methylcarbamothioyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)NCc1ccc(-c2ccc(Br)cc2)o1)c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C23H15BrCl2N2O3S/c24-14-3-1-13(2-4-14)19-8-6-16(30-19)12-27-23(32)28-22(29)21-10-9-20(31-21)17-11-15(25)5-7-18(17)26/h1-11H,12H2,(H2,27,28,29,32) |
| InChIKey | RWXNGTMCTPCFTI-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.26 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|