C19H21ClN4O3S — CID 24674627
2-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]propanoylamino]thiophene-3-carboxamide (PubChem CID 24674627) has the molecular formula C19H21ClN4O3S and a molecular weight of 420.92 g/mol. Its IUPAC name is 2-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]propanoylamino]thiophene-3-carboxamide.
| Compound Name | 2-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]propanoylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 24674627 |
| Molecular Formula | C19H21ClN4O3S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 2-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]propanoylamino]thiophene-3-carboxamide |
| SMILES | CC(C(=O)Nc1sccc1C(N)=O)N1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H21ClN4O3S/c1-12(17(26)22-18-15(16(21)25)6-11-28-18)23-7-9-24(10-8-23)19(27)13-2-4-14(20)5-3-13/h2-6,11-12H,7-10H2,1H3,(H2,21,25)(H,22,26) |
| InChIKey | IUTHAAMKDYNFDE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |