C18H19FN4O3S — CID 36875697
2-[[2-[4-(4-fluorobenzoyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxamide (PubChem CID 36875697) has the molecular formula C18H19FN4O3S and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[[2-[4-(4-fluorobenzoyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[4-(4-fluorobenzoyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 36875697 |
| Molecular Formula | C18H19FN4O3S |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-[[2-[4-(4-fluorobenzoyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)CN1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H19FN4O3S/c19-13-3-1-12(2-4-13)18(26)23-8-6-22(7-9-23)11-15(24)21-17-14(16(20)25)5-10-27-17/h1-5,10H,6-9,11H2,(H2,20,25)(H,21,24) |
| InChIKey | ARCMZJGDKVIBDD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |