C16H18N4O3S2 — CID 9362622
2-[[2-[4-(thiophene-2-carbonyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxamide (PubChem CID 9362622) has the molecular formula C16H18N4O3S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-[[2-[4-(thiophene-2-carbonyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[4-(thiophene-2-carbonyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 9362622 |
| Molecular Formula | C16H18N4O3S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-[[2-[4-(thiophene-2-carbonyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)CN1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C16H18N4O3S2/c17-14(22)11-3-9-25-15(11)18-13(21)10-19-4-6-20(7-5-19)16(23)12-2-1-8-24-12/h1-3,8-9H,4-7,10H2,(H2,17,22)(H,18,21) |
| InChIKey | PPXPZLQEOVAYHB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |