C17H20N4O3S — CID 27156572
2-[[2-[4-(2-hydroxyphenyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxamide (PubChem CID 27156572) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-[[2-[4-(2-hydroxyphenyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[4-(2-hydroxyphenyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 27156572 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[[2-[4-(2-hydroxyphenyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)CN1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C17H20N4O3S/c18-16(24)12-5-10-25-17(12)19-15(23)11-20-6-8-21(9-7-20)13-3-1-2-4-14(13)22/h1-5,10,22H,6-9,11H2,(H2,18,24)(H,19,23) |
| InChIKey | HIAMRTXHUPBHLY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |