About 3-Acetamidoprop-2-enoic acid
3-Acetamidoprop-2-enoic acid (PubChem CID 246752) has the molecular formula C5H7NO3
and a molecular weight of 129.11 g/mol. Its IUPAC name is 3-acetamidoprop-2-enoic acid.
Molecular Properties
| Compound Name | 3-Acetamidoprop-2-enoic acid |
| PubChem CID | 246752 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 3-acetamidoprop-2-enoic acid |
| SMILES | CC(=O)NC=CC(=O)O |
| InChI | InChI=1S/C5H7NO3/c1-4(7)6-3-2-5(8)9/h2-3H,1H3,(H,6,7)(H,8,9) |
| InChIKey | MWVBVDJUFFMLAR-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | 150 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-Acetamidoprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Acetamidoprop-2-enoic acid?
The IUPAC name of 3-Acetamidoprop-2-enoic acid (CID 246752) is 3-acetamidoprop-2-enoic acid.
What is the SMILES notation for 3-Acetamidoprop-2-enoic acid?
The canonical SMILES for 3-Acetamidoprop-2-enoic acid is CC(=O)NC=CC(=O)O.
What is the InChIKey of 3-Acetamidoprop-2-enoic acid?
The InChIKey is MWVBVDJUFFMLAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3/c1-4(7)6-3-2-5(8)9/h2-3H,1H3,(H,6,7)(H,8,9).
What are the key properties of 3-Acetamidoprop-2-enoic acid?
3-Acetamidoprop-2-enoic acid has a molecular weight of 129.11 g/mol, XLogP of -0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Acetamidoprop-2-enoic acid is sourced from PubChem (CID 246752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).