About N-ethenylacetamide;prop-2-enoic acid
N-ethenylacetamide;prop-2-enoic acid (PubChem CID 87974681) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is N-ethenylacetamide;prop-2-enoic acid.
Molecular Properties
| Compound Name | N-ethenylacetamide;prop-2-enoic acid |
| PubChem CID | 87974681 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | N-ethenylacetamide;prop-2-enoic acid |
| SMILES | C=CC(=O)O.C=CNC(C)=O |
| InChI | InChI=1S/C4H7NO.C3H4O2/c1-3-5-4(2)6;1-2-3(4)5/h3H,1H2,2H3,(H,5,6);2H,1H2,(H,4,5) |
| InChIKey | NCFAAXNAPQCDBL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethenylacetamide;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenylacetamide;prop-2-enoic acid?
The IUPAC name of N-ethenylacetamide;prop-2-enoic acid (CID 87974681) is N-ethenylacetamide;prop-2-enoic acid.
What is the SMILES notation for N-ethenylacetamide;prop-2-enoic acid?
The canonical SMILES for N-ethenylacetamide;prop-2-enoic acid is C=CC(=O)O.C=CNC(C)=O.
What is the InChIKey of N-ethenylacetamide;prop-2-enoic acid?
The InChIKey is NCFAAXNAPQCDBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO.C3H4O2/c1-3-5-4(2)6;1-2-3(4)5/h3H,1H2,2H3,(H,5,6);2H,1H2,(H,4,5).
What are the key properties of N-ethenylacetamide;prop-2-enoic acid?
N-ethenylacetamide;prop-2-enoic acid has a molecular weight of 157.17 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenylacetamide;prop-2-enoic acid is sourced from PubChem (CID 87974681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).