C22H24N4O4 — CID 24675990
3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide (PubChem CID 24675990) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide.
| Compound Name | 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 24675990 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide |
| SMILES | CC(C(=O)Nc1cc(C(N)=O)ccc1N1CCCCC1)n1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C22H24N4O4/c1-14(26-18-7-3-4-8-19(18)30-22(26)29)21(28)24-16-13-15(20(23)27)9-10-17(16)25-11-5-2-6-12-25/h3-4,7-10,13-14H,2,5-6,11-12H2,1H3,(H2,23,27)(H,24,28) |
| InChIKey | HTJIAVAUSVPKML-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |