About 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide
3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide (PubChem CID 24675990) has the molecular formula C22H24N4O4
and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide.
Molecular Properties
| Compound Name | 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide |
| PubChem CID | 24675990 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide |
| SMILES | CC(C(=O)Nc1cc(C(N)=O)ccc1N1CCCCC1)n1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C22H24N4O4/c1-14(26-18-7-3-4-8-19(18)30-22(26)29)21(28)24-16-13-15(20(23)27)9-10-17(16)25-11-5-2-6-12-25/h3-4,7-10,13-14H,2,5-6,11-12H2,1H3,(H2,23,27)(H,24,28) |
| InChIKey | HTJIAVAUSVPKML-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide?
The IUPAC name of 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide (CID 24675990) is 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide.
What is the SMILES notation for 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide?
The canonical SMILES for 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide is CC(C(=O)Nc1cc(C(N)=O)ccc1N1CCCCC1)n1c(=O)oc2ccccc21.
What is the InChIKey of 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide?
The InChIKey is HTJIAVAUSVPKML-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O4/c1-14(26-18-7-3-4-8-19(18)30-22(26)29)21(28)24-16-13-15(20(23)27)9-10-17(16)25-11-5-2-6-12-25/h3-4,7-10,13-14H,2,5-6,11-12H2,1H3,(H2,23,27)(H,24,28).
What are the key properties of 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide?
3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide has a molecular weight of 408.46 g/mol, XLogP of 2.88, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-4-piperidin-1-ylbenzamide is sourced from PubChem (CID 24675990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).