C25H25N3O4S — CID 24676587
N-benzyl-2-[[2-[[(E)-2-(4-methylphenyl)ethenyl]sulfonylamino]acetyl]amino]benzamide (PubChem CID 24676587) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-benzyl-2-[[2-[[(E)-2-(4-methylphenyl)ethenyl]sulfonylamino]acetyl]amino]benzamide.
| Compound Name | N-benzyl-2-[[2-[[(E)-2-(4-methylphenyl)ethenyl]sulfonylamino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 24676587 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-benzyl-2-[[2-[[(E)-2-(4-methylphenyl)ethenyl]sulfonylamino]acetyl]amino]benzamide |
| SMILES | Cc1ccc(/C=C/S(=O)(=O)NCC(=O)Nc2ccccc2C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O4S/c1-19-11-13-20(14-12-19)15-16-33(31,32)27-18-24(29)28-23-10-6-5-9-22(23)25(30)26-17-21-7-3-2-4-8-21/h2-16,27H,17-18H2,1H3,(H,26,30)(H,28,29)/b16-15+ |
| InChIKey | KAWJZFSOVPRWHX-FOCLMDBBSA-N |
| XLogP | 3.45 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |