C27H24N2O5S — CID 24677975
2-oxo-N-[[2-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]phenyl]methyl]chromene-6-sulfonamide (PubChem CID 24677975) has the molecular formula C27H24N2O5S and a molecular weight of 488.57 g/mol. Its IUPAC name is 2-oxo-N-[[2-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]phenyl]methyl]chromene-6-sulfonamide.
| Compound Name | 2-oxo-N-[[2-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]phenyl]methyl]chromene-6-sulfonamide |
|---|---|
| PubChem CID | 24677975 |
| Molecular Formula | C27H24N2O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-oxo-N-[[2-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]phenyl]methyl]chromene-6-sulfonamide |
| SMILES | O=C1CCCN1Cc1ccc(-c2ccccc2CNS(=O)(=O)c2ccc3oc(=O)ccc3c2)cc1 |
| InChI | InChI=1S/C27H24N2O5S/c30-26-6-3-15-29(26)18-19-7-9-20(10-8-19)24-5-2-1-4-22(24)17-28-35(32,33)23-12-13-25-21(16-23)11-14-27(31)34-25/h1-2,4-5,7-14,16,28H,3,6,15,17-18H2 |
| InChIKey | NMLWLWLHWQMBTQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|