C24H22N4O6S — CID 24679324
N-cyclopropyl-4-[[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl-(furan-2-ylmethyl)amino]methyl]benzamide (PubChem CID 24679324) has the molecular formula C24H22N4O6S and a molecular weight of 494.53 g/mol. Its IUPAC name is N-cyclopropyl-4-[[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl-(furan-2-ylmethyl)amino]methyl]benzamide.
| Compound Name | N-cyclopropyl-4-[[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl-(furan-2-ylmethyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 24679324 |
| Molecular Formula | C24H22N4O6S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | N-cyclopropyl-4-[[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl-(furan-2-ylmethyl)amino]methyl]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(CN(Cc2ccco2)S(=O)(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C24H22N4O6S/c29-22(25-17-7-8-17)16-5-3-15(4-6-16)13-28(14-18-2-1-11-34-18)35(32,33)19-9-10-20-21(12-19)27-24(31)23(30)26-20/h1-6,9-12,17H,7-8,13-14H2,(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | SUKCFDQHHDRWLI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 145.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|