C24H22FN3O4S — CID 24679893
2-[4-[3-[5-(2-fluorophenyl)furan-2-yl]propanoyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 24679893) has the molecular formula C24H22FN3O4S and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-[4-[3-[5-(2-fluorophenyl)furan-2-yl]propanoyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[3-[5-(2-fluorophenyl)furan-2-yl]propanoyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 24679893 |
| Molecular Formula | C24H22FN3O4S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 2-[4-[3-[5-(2-fluorophenyl)furan-2-yl]propanoyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCN(C(=O)CCc2ccc(-c3ccccc3F)o2)CC1 |
| InChI | InChI=1S/C24H22FN3O4S/c25-21-7-3-2-6-20(21)22-11-9-19(32-22)10-12-24(29)27-13-15-28(16-14-27)33(30,31)23-8-4-1-5-18(23)17-26/h1-9,11H,10,12-16H2 |
| InChIKey | BFXKYOVYZTWUJA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 94.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |