C21H25N3O6S2 — CID 24680805
3-(cyclopropylsulfamoyl)-N-[(2-morpholin-4-ylsulfonylphenyl)methyl]benzamide (PubChem CID 24680805) has the molecular formula C21H25N3O6S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-N-[(2-morpholin-4-ylsulfonylphenyl)methyl]benzamide.
| Compound Name | 3-(cyclopropylsulfamoyl)-N-[(2-morpholin-4-ylsulfonylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 24680805 |
| Molecular Formula | C21H25N3O6S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-N-[(2-morpholin-4-ylsulfonylphenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccccc1S(=O)(=O)N1CCOCC1)c1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C21H25N3O6S2/c25-21(16-5-3-6-19(14-16)31(26,27)23-18-8-9-18)22-15-17-4-1-2-7-20(17)32(28,29)24-10-12-30-13-11-24/h1-7,14,18,23H,8-13,15H2,(H,22,25) |
| InChIKey | ZZTLNZSPPRSSDP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |