C20H22F2N2O4S — CID 46588506
3-(cyclopentylsulfamoyl)-N-[[2-(difluoromethoxy)phenyl]methyl]benzamide (PubChem CID 46588506) has the molecular formula C20H22F2N2O4S and a molecular weight of 424.47 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N-[[2-(difluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N-[[2-(difluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 46588506 |
| Molecular Formula | C20H22F2N2O4S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N-[[2-(difluoromethoxy)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccccc1OC(F)F)c1cccc(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C20H22F2N2O4S/c21-20(22)28-18-11-4-1-6-15(18)13-23-19(25)14-7-5-10-17(12-14)29(26,27)24-16-8-2-3-9-16/h1,4-7,10-12,16,20,24H,2-3,8-9,13H2,(H,23,25) |
| InChIKey | VWRSCJDTEICGEI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |