C21H23F2N3O5S — CID 41368824
3-(4-acetylpiperazin-1-yl)sulfonyl-N-[[2-(difluoromethoxy)phenyl]methyl]benzamide (PubChem CID 41368824) has the molecular formula C21H23F2N3O5S and a molecular weight of 467.49 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)sulfonyl-N-[[2-(difluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-[[2-(difluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 41368824 |
| Molecular Formula | C21H23F2N3O5S |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-[[2-(difluoromethoxy)phenyl]methyl]benzamide |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2cccc(C(=O)NCc3ccccc3OC(F)F)c2)CC1 |
| InChI | InChI=1S/C21H23F2N3O5S/c1-15(27)25-9-11-26(12-10-25)32(29,30)18-7-4-6-16(13-18)20(28)24-14-17-5-2-3-8-19(17)31-21(22)23/h2-8,13,21H,9-12,14H2,1H3,(H,24,28) |
| InChIKey | PBMXPUUGOKETHU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |