C25H30N4O4S — CID 24681303
3-[[2-[2-(diethylamino)-4-oxo-1,3-thiazol-5-yl]acetyl]amino]-N-[2-(4-methylphenoxy)ethyl]benzamide (PubChem CID 24681303) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is 3-[[2-[2-(diethylamino)-4-oxo-1,3-thiazol-5-yl]acetyl]amino]-N-[2-(4-methylphenoxy)ethyl]benzamide.
| Compound Name | 3-[[2-[2-(diethylamino)-4-oxo-1,3-thiazol-5-yl]acetyl]amino]-N-[2-(4-methylphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 24681303 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 3-[[2-[2-(diethylamino)-4-oxo-1,3-thiazol-5-yl]acetyl]amino]-N-[2-(4-methylphenoxy)ethyl]benzamide |
| SMILES | CCN(CC)C1=NC(=O)C(CC(=O)Nc2cccc(C(=O)NCCOc3ccc(C)cc3)c2)S1 |
| InChI | InChI=1S/C25H30N4O4S/c1-4-29(5-2)25-28-24(32)21(34-25)16-22(30)27-19-8-6-7-18(15-19)23(31)26-13-14-33-20-11-9-17(3)10-12-20/h6-12,15,21H,4-5,13-14,16H2,1-3H3,(H,26,31)(H,27,30) |
| InChIKey | YPDHDEUPTFZCSR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|