C12H15N3S2 — CID 2468150
2-(4-methylpiperazin-1-yl)-4-thiophen-2-yl-1,3-thiazole (PubChem CID 2468150) has the molecular formula C12H15N3S2 and a molecular weight of 265.41 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-4-thiophen-2-yl-1,3-thiazole.
| Compound Name | 2-(4-methylpiperazin-1-yl)-4-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 2468150 |
| Molecular Formula | C12H15N3S2 |
| Molecular Weight | 265.41 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-4-thiophen-2-yl-1,3-thiazole |
| SMILES | CN1CCN(c2nc(-c3cccs3)cs2)CC1 |
| InChI | InChI=1S/C12H15N3S2/c1-14-4-6-15(7-5-14)12-13-10(9-17-12)11-3-2-8-16-11/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | RBDUXCOZGSVXEU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |