About N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide
N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide (PubChem CID 57392815) has the molecular formula C13H19N3O2S3
and a molecular weight of 345.52 g/mol. Its IUPAC name is N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide |
| PubChem CID | 57392815 |
| Molecular Formula | C13H19N3O2S3 |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCCCNc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C13H19N3O2S3/c1-21(17,18)15-8-4-2-3-7-14-13-16-11(10-20-13)12-6-5-9-19-12/h5-6,9-10,15H,2-4,7-8H2,1H3,(H,14,16) |
| InChIKey | DVZYVWHRGWWQFD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide?
The IUPAC name of N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide (CID 57392815) is N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide.
What is the SMILES notation for N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide?
The canonical SMILES for N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide is CS(=O)(=O)NCCCCCNc1nc(-c2cccs2)cs1.
What is the InChIKey of N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide?
The InChIKey is DVZYVWHRGWWQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2S3/c1-21(17,18)15-8-4-2-3-7-14-13-16-11(10-20-13)12-6-5-9-19-12/h5-6,9-10,15H,2-4,7-8H2,1H3,(H,14,16).
What are the key properties of N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide?
N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide has a molecular weight of 345.52 g/mol, XLogP of 3.00, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide is sourced from PubChem (CID 57392815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).