C23H17BrN4O4 — CID 24681676
N-[2-(2-bromoanilino)-2-oxoethyl]-2,4-dioxo-3-phenyl-1H-quinazoline-7-carboxamide (PubChem CID 24681676) has the molecular formula C23H17BrN4O4 and a molecular weight of 493.32 g/mol. Its IUPAC name is N-[2-(2-bromoanilino)-2-oxoethyl]-2,4-dioxo-3-phenyl-1H-quinazoline-7-carboxamide.
| Compound Name | N-[2-(2-bromoanilino)-2-oxoethyl]-2,4-dioxo-3-phenyl-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 24681676 |
| Molecular Formula | C23H17BrN4O4 |
| Molecular Weight | 493.32 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | N-[2-(2-bromoanilino)-2-oxoethyl]-2,4-dioxo-3-phenyl-1H-quinazoline-7-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2c(=O)n(-c3ccccc3)c(=O)[nH]c2c1)Nc1ccccc1Br |
| InChI | InChI=1S/C23H17BrN4O4/c24-17-8-4-5-9-18(17)26-20(29)13-25-21(30)14-10-11-16-19(12-14)27-23(32)28(22(16)31)15-6-2-1-3-7-15/h1-12H,13H2,(H,25,30)(H,26,29)(H,27,32) |
| InChIKey | WNMORYTZFSYIHA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |