C22H27N3O5S2 — CID 24683731
4-[2-[3-(1-methoxypropan-2-yl)-4-oxoquinazolin-2-yl]sulfanylethoxy]-N,N-dimethylbenzenesulfonamide (PubChem CID 24683731) has the molecular formula C22H27N3O5S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 4-[2-[3-(1-methoxypropan-2-yl)-4-oxoquinazolin-2-yl]sulfanylethoxy]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-[3-(1-methoxypropan-2-yl)-4-oxoquinazolin-2-yl]sulfanylethoxy]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 24683731 |
| Molecular Formula | C22H27N3O5S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 4-[2-[3-(1-methoxypropan-2-yl)-4-oxoquinazolin-2-yl]sulfanylethoxy]-N,N-dimethylbenzenesulfonamide |
| SMILES | COCC(C)n1c(SCCOc2ccc(S(=O)(=O)N(C)C)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H27N3O5S2/c1-16(15-29-4)25-21(26)19-7-5-6-8-20(19)23-22(25)31-14-13-30-17-9-11-18(12-10-17)32(27,28)24(2)3/h5-12,16H,13-15H2,1-4H3 |
| InChIKey | UYRDJSFQTRLPCN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|