C24H23N5O3 — CID 24685185
2-phenyl-4-N-(3-phenylmethoxypropyl)imidazo[1,5-a]pyrimidine-4,8-dicarboxamide (PubChem CID 24685185) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 2-phenyl-4-N-(3-phenylmethoxypropyl)imidazo[1,5-a]pyrimidine-4,8-dicarboxamide.
| Compound Name | 2-phenyl-4-N-(3-phenylmethoxypropyl)imidazo[1,5-a]pyrimidine-4,8-dicarboxamide |
|---|---|
| PubChem CID | 24685185 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 2-phenyl-4-N-(3-phenylmethoxypropyl)imidazo[1,5-a]pyrimidine-4,8-dicarboxamide |
| SMILES | NC(=O)c1ncn2c(C(=O)NCCCOCc3ccccc3)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C24H23N5O3/c25-22(30)21-23-28-19(18-10-5-2-6-11-18)14-20(29(23)16-27-21)24(31)26-12-7-13-32-15-17-8-3-1-4-9-17/h1-6,8-11,14,16H,7,12-13,15H2,(H2,25,30)(H,26,31) |
| InChIKey | KOVWEOBVVMLRED-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|