C25H32N2O5S — CID 24685201
(E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-N-(3-methyl-1-phenylbutyl)prop-2-enamide (PubChem CID 24685201) has the molecular formula C25H32N2O5S and a molecular weight of 472.61 g/mol. Its IUPAC name is (E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-N-(3-methyl-1-phenylbutyl)prop-2-enamide.
| Compound Name | (E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-N-(3-methyl-1-phenylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 24685201 |
| Molecular Formula | C25H32N2O5S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | (E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-N-(3-methyl-1-phenylbutyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(CC(C)C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H32N2O5S/c1-19(2)17-22(21-7-5-4-6-8-21)26-25(28)12-10-20-9-11-23(31-3)24(18-20)33(29,30)27-13-15-32-16-14-27/h4-12,18-19,22H,13-17H2,1-3H3,(H,26,28)/b12-10+ |
| InChIKey | KWRQLCMZPQGNPG-ZRDIBKRKSA-N |
| XLogP | 3.63 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|