C28H27N3O — CID 24685354
N-[4-(6-methyl-4-phenylquinolin-2-yl)phenyl]-2-pyrrolidin-1-ylacetamide (PubChem CID 24685354) has the molecular formula C28H27N3O and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[4-(6-methyl-4-phenylquinolin-2-yl)phenyl]-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-[4-(6-methyl-4-phenylquinolin-2-yl)phenyl]-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 24685354 |
| Molecular Formula | C28H27N3O |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N-[4-(6-methyl-4-phenylquinolin-2-yl)phenyl]-2-pyrrolidin-1-ylacetamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)CN4CCCC4)cc3)cc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C28H27N3O/c1-20-9-14-26-25(17-20)24(21-7-3-2-4-8-21)18-27(30-26)22-10-12-23(13-11-22)29-28(32)19-31-15-5-6-16-31/h2-4,7-14,17-18H,5-6,15-16,19H2,1H3,(H,29,32) |
| InChIKey | CHSMPIUZXLPBGT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |